C68H51N3 — CID 134431639
N-[(1Z)-1-[3-[11-(9,9-dimethyl-10-phenylacridin-3-yl)benzo[c]carbazol-7-yl]phenyl]-3-(4-phenylphenyl)buta-1,3-dienyl]-1-phenylprop-2-en-1-imine (PubChem CID 134431639) has the molecular formula C68H51N3 and a molecular weight of 910.18 g/mol. Its IUPAC name is N-[(1Z)-1-[3-[11-(9,9-dimethyl-10-phenylacridin-3-yl)benzo[c]carbazol-7-yl]phenyl]-3-(4-phenylphenyl)buta-1,3-dienyl]-1-phenylprop-2-en-1-imine.
| Compound Name | N-[(1Z)-1-[3-[11-(9,9-dimethyl-10-phenylacridin-3-yl)benzo[c]carbazol-7-yl]phenyl]-3-(4-phenylphenyl)buta-1,3-dienyl]-1-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 134431639 |
| Molecular Formula | C68H51N3 |
| Molecular Weight | 910.18 g/mol |
| Exact Mass | 909.41 |
| IUPAC Name | N-[(1Z)-1-[3-[11-(9,9-dimethyl-10-phenylacridin-3-yl)benzo[c]carbazol-7-yl]phenyl]-3-(4-phenylphenyl)buta-1,3-dienyl]-1-phenylprop-2-en-1-imine |
| SMILES | C=C/C(=N\C(=C/C(=C)c1ccc(-c2ccccc2)cc1)c1cccc(-n2c3cccc(-c4ccc5c(c4)N(c4ccccc4)c4ccccc4C5(C)C)c3c3c4ccccc4ccc32)c1)c1ccccc1 |
| InChI | InChI=1S/C68H51N3/c1-5-60(51-24-11-7-12-25-51)69-61(43-46(2)47-35-37-49(38-36-47)48-21-9-6-10-22-48)53-26-19-29-55(44-53)71-63-34-20-31-57(67(63)66-56-30-16-15-23-50(56)40-42-64(66)71)52-39-41-59-65(45-52)70(54-27-13-8-14-28-54)62-33-18-17-32-58(62)68(59,3)4/h5-45H,1-2H2,3-4H3/b61-43-,69-60+ |
| InChIKey | QQKRKVUMSRFZHO-SDYOXOLFSA-N |
| XLogP | 18.11 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.18 |
| LogP ≤ 5 | 18.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|