C37H26FN3 — CID 156570977
13-[(1Z)-buta-1,3-dienyl]-14-(4-fluorophenyl)-12-methyl-9-phenyl-9,14,23-triazahexacyclo[14.7.0.02,10.03,8.011,15.017,22]tricosa-1(16),2(10),3,5,7,11(15),12,17,19,21-decaene (PubChem CID 156570977) has the molecular formula C37H26FN3 and a molecular weight of 531.63 g/mol. Its IUPAC name is 13-[(1Z)-buta-1,3-dienyl]-14-(4-fluorophenyl)-12-methyl-9-phenyl-9,14,23-triazahexacyclo[14.7.0.02,10.03,8.011,15.017,22]tricosa-1(16),2(10),3,5,7,11(15),12,17,19,21-decaene.
| Compound Name | 13-[(1Z)-buta-1,3-dienyl]-14-(4-fluorophenyl)-12-methyl-9-phenyl-9,14,23-triazahexacyclo[14.7.0.02,10.03,8.011,15.017,22]tricosa-1(16),2(10),3,5,7,11(15),12,17,19,21-decaene |
|---|---|
| PubChem CID | 156570977 |
| Molecular Formula | C37H26FN3 |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | 13-[(1Z)-buta-1,3-dienyl]-14-(4-fluorophenyl)-12-methyl-9-phenyl-9,14,23-triazahexacyclo[14.7.0.02,10.03,8.011,15.017,22]tricosa-1(16),2(10),3,5,7,11(15),12,17,19,21-decaene |
| SMILES | C=C/C=C\c1c(C)c2c(c3c4ccccc4[nH]c3c3c4ccccc4n(-c4ccccc4)c23)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C37H26FN3/c1-3-4-17-30-23(2)32-36(40(30)26-21-19-24(38)20-22-26)33-27-14-8-10-16-29(27)39-35(33)34-28-15-9-11-18-31(28)41(37(32)34)25-12-6-5-7-13-25/h3-22,39H,1H2,2H3/b17-4- |
| InChIKey | UOESDKJVMNTLRP-INGKJJEOSA-N |
| XLogP | 10.01 |
| TPSA | 25.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|