C27H21ClN2 — CID 167029205
2-[(1Z)-buta-1,3-dienyl]-5-(3-chloroindol-1-yl)-3-methyl-1-phenylindole (PubChem CID 167029205) has the molecular formula C27H21ClN2 and a molecular weight of 408.93 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-5-(3-chloroindol-1-yl)-3-methyl-1-phenylindole.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-5-(3-chloroindol-1-yl)-3-methyl-1-phenylindole |
|---|---|
| PubChem CID | 167029205 |
| Molecular Formula | C27H21ClN2 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-5-(3-chloroindol-1-yl)-3-methyl-1-phenylindole |
| SMILES | C=C/C=C\c1c(C)c2cc(-n3cc(Cl)c4ccccc43)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C27H21ClN2/c1-3-4-13-25-19(2)23-17-21(29-18-24(28)22-12-8-9-14-26(22)29)15-16-27(23)30(25)20-10-6-5-7-11-20/h3-18H,1H2,2H3/b13-4- |
| InChIKey | BTHBOPJZBDBPLU-PQMHYQBVSA-N |
| XLogP | 7.74 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|