C56H44N2 — CID 138467856
N-[4-[3-[2-[(1Z)-buta-1,3-dienyl]-3-methylindol-1-yl]phenyl]phenyl]-N-[4-[3-(4-methylphenyl)phenyl]phenyl]-4-phenylaniline (PubChem CID 138467856) has the molecular formula C56H44N2 and a molecular weight of 744.98 g/mol. Its IUPAC name is N-[4-[3-[2-[(1Z)-buta-1,3-dienyl]-3-methylindol-1-yl]phenyl]phenyl]-N-[4-[3-(4-methylphenyl)phenyl]phenyl]-4-phenylaniline.
| Compound Name | N-[4-[3-[2-[(1Z)-buta-1,3-dienyl]-3-methylindol-1-yl]phenyl]phenyl]-N-[4-[3-(4-methylphenyl)phenyl]phenyl]-4-phenylaniline |
|---|---|
| PubChem CID | 138467856 |
| Molecular Formula | C56H44N2 |
| Molecular Weight | 744.98 g/mol |
| Exact Mass | 744.35 |
| IUPAC Name | N-[4-[3-[2-[(1Z)-buta-1,3-dienyl]-3-methylindol-1-yl]phenyl]phenyl]-N-[4-[3-(4-methylphenyl)phenyl]phenyl]-4-phenylaniline |
| SMILES | C=C/C=C\c1c(C)c2ccccc2n1-c1cccc(-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4cccc(-c5ccc(C)cc5)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C56H44N2/c1-4-5-20-55-41(3)54-19-9-10-21-56(54)58(55)53-18-12-17-49(39-53)46-30-36-52(37-31-46)57(50-32-26-43(27-33-50)42-13-7-6-8-14-42)51-34-28-45(29-35-51)48-16-11-15-47(38-48)44-24-22-40(2)23-25-44/h4-39H,1H2,2-3H3/b20-5- |
| InChIKey | PBDLBBBWMNQAII-SDPNRITHSA-N |
| XLogP | 15.58 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.98 |
| LogP ≤ 5 | 15.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|