C42H31NO — CID 139418385
(E)-3-phenyl-N-(1-phenylethenyl)-1-[6-(3-phenylphenyl)dibenzofuran-1-yl]but-2-en-1-imine (PubChem CID 139418385) has the molecular formula C42H31NO and a molecular weight of 565.72 g/mol. Its IUPAC name is (E)-3-phenyl-N-(1-phenylethenyl)-1-[6-(3-phenylphenyl)dibenzofuran-1-yl]but-2-en-1-imine.
| Compound Name | (E)-3-phenyl-N-(1-phenylethenyl)-1-[6-(3-phenylphenyl)dibenzofuran-1-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 139418385 |
| Molecular Formula | C42H31NO |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | (E)-3-phenyl-N-(1-phenylethenyl)-1-[6-(3-phenylphenyl)dibenzofuran-1-yl]but-2-en-1-imine |
| SMILES | C=C(/N=C(\C=C(/C)c1ccccc1)c1cccc2oc3c(-c4cccc(-c5ccccc5)c4)cccc3c12)c1ccccc1 |
| InChI | InChI=1S/C42H31NO/c1-29(31-15-6-3-7-16-31)27-39(43-30(2)32-17-8-4-9-18-32)37-24-14-26-40-41(37)38-25-13-23-36(42(38)44-40)35-22-12-21-34(28-35)33-19-10-5-11-20-33/h3-28H,2H2,1H3/b29-27+,43-39+ |
| InChIKey | KCXFTRCPRVWCRZ-CIFBXTGLSA-N |
| XLogP | 11.48 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|