C45H29N3O2 — CID 176837498
N-[(3-dibenzofuran-4-ylphenyl)methylidene]-N'-(3-phenylbenzenecarboximidoyl)dibenzofuran-1-carboximidamide (PubChem CID 176837498) has the molecular formula C45H29N3O2 and a molecular weight of 643.75 g/mol. Its IUPAC name is N-[(3-dibenzofuran-4-ylphenyl)methylidene]-N'-(3-phenylbenzenecarboximidoyl)dibenzofuran-1-carboximidamide.
| Compound Name | N-[(3-dibenzofuran-4-ylphenyl)methylidene]-N'-(3-phenylbenzenecarboximidoyl)dibenzofuran-1-carboximidamide |
|---|---|
| PubChem CID | 176837498 |
| Molecular Formula | C45H29N3O2 |
| Molecular Weight | 643.75 g/mol |
| Exact Mass | 643.23 |
| IUPAC Name | N-[(3-dibenzofuran-4-ylphenyl)methylidene]-N'-(3-phenylbenzenecarboximidoyl)dibenzofuran-1-carboximidamide |
| SMILES | [H]/N=C(/N=C(/N=C/c1cccc(-c2cccc3c2oc2ccccc23)c1)c1cccc2oc3ccccc3c12)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C45H29N3O2/c46-44(33-17-9-15-31(27-33)30-13-2-1-3-14-30)48-45(38-22-11-25-41-42(38)37-19-5-7-24-40(37)49-41)47-28-29-12-8-16-32(26-29)34-20-10-21-36-35-18-4-6-23-39(35)50-43(34)36/h1-28,46H/b46-44+,47-28+,48-45+ |
| InChIKey | QIZQQRCXVKPVKA-DMSGFAHLSA-N |
| XLogP | 11.71 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.75 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|