C49H31N7O — CID 163703130
N'-(benzenecarboximidoyl)-4-(4-cyanophenyl)-N-[[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]methylidene]benzenecarboximidamide (PubChem CID 163703130) has the molecular formula C49H31N7O and a molecular weight of 733.84 g/mol. Its IUPAC name is N'-(benzenecarboximidoyl)-4-(4-cyanophenyl)-N-[[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]methylidene]benzenecarboximidamide.
| Compound Name | N'-(benzenecarboximidoyl)-4-(4-cyanophenyl)-N-[[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]methylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 163703130 |
| Molecular Formula | C49H31N7O |
| Molecular Weight | 733.84 g/mol |
| Exact Mass | 733.26 |
| IUPAC Name | N'-(benzenecarboximidoyl)-4-(4-cyanophenyl)-N-[[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]methylidene]benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(/N=C\c1ccc2oc3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2c1)c1ccc(-c2ccc(C#N)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C49H31N7O/c50-30-32-19-22-34(23-20-32)35-24-26-39(27-25-35)46(53-45(51)36-11-4-1-5-12-36)52-31-33-21-28-42-41(29-33)44-40(17-10-18-43(44)57-42)49-55-47(37-13-6-2-7-14-37)54-48(56-49)38-15-8-3-9-16-38/h1-29,31,51H/b51-45+,52-31-,53-46+ |
| InChIKey | KCTMSGOJMBWGLV-RXKLHXDYSA-N |
| XLogP | 11.20 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.84 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|