C51H32N4OS — CID 176767129
N'-[4-([1]benzofuro[3,2-c]carbazol-5-yl)benzenecarboximidoyl]-N-(dibenzothiophen-3-ylmethylidene)-3-phenylbenzenecarboximidamide (PubChem CID 176767129) has the molecular formula C51H32N4OS and a molecular weight of 748.91 g/mol. Its IUPAC name is N'-[4-([1]benzofuro[3,2-c]carbazol-5-yl)benzenecarboximidoyl]-N-(dibenzothiophen-3-ylmethylidene)-3-phenylbenzenecarboximidamide.
| Compound Name | N'-[4-([1]benzofuro[3,2-c]carbazol-5-yl)benzenecarboximidoyl]-N-(dibenzothiophen-3-ylmethylidene)-3-phenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 176767129 |
| Molecular Formula | C51H32N4OS |
| Molecular Weight | 748.91 g/mol |
| Exact Mass | 748.23 |
| IUPAC Name | N'-[4-([1]benzofuro[3,2-c]carbazol-5-yl)benzenecarboximidoyl]-N-(dibenzothiophen-3-ylmethylidene)-3-phenylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N=C(/N=C/c1ccc2c(c1)sc1ccccc12)c1cccc(-c2ccccc2)c1)c1ccc(-n2c3ccccc3c3c4oc5ccccc5c4ccc32)cc1 |
| InChI | InChI=1S/C51H32N4OS/c52-50(34-22-24-37(25-23-34)55-43-18-7-4-17-42(43)48-44(55)28-27-41-38-15-5-8-19-45(38)56-49(41)48)54-51(36-14-10-13-35(30-36)33-11-2-1-3-12-33)53-31-32-21-26-40-39-16-6-9-20-46(39)57-47(40)29-32/h1-31,52H/b52-50-,53-31+,54-51- |
| InChIKey | ICQNVTNRWTXAQK-UUTJPTDUSA-N |
| XLogP | 13.61 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.91 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|