C51H34N4S — CID 171771566
N-[(benzylideneamino)-phenylmethylidene]-5-phenyl-2-(14-phenyl-9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaen-6-yl)benzenecarboximidamide (PubChem CID 171771566) has the molecular formula C51H34N4S and a molecular weight of 734.93 g/mol. Its IUPAC name is N-[(benzylideneamino)-phenylmethylidene]-5-phenyl-2-(14-phenyl-9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaen-6-yl)benzenecarboximidamide.
| Compound Name | N-[(benzylideneamino)-phenylmethylidene]-5-phenyl-2-(14-phenyl-9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaen-6-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 171771566 |
| Molecular Formula | C51H34N4S |
| Molecular Weight | 734.93 g/mol |
| Exact Mass | 734.25 |
| IUPAC Name | N-[(benzylideneamino)-phenylmethylidene]-5-phenyl-2-(14-phenyl-9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaen-6-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N=C(/N=C/c1ccccc1)c1ccccc1)c1cc(-c2ccccc2)ccc1-c1ccc2c(c1)sc1ccc3c(c4ccccc4n3-c3ccccc3)c12 |
| InChI | InChI=1S/C51H34N4S/c52-50(54-51(36-19-9-3-10-20-36)53-33-34-15-5-1-6-16-34)43-31-37(35-17-7-2-8-18-35)25-27-40(43)38-26-28-42-47(32-38)56-46-30-29-45-48(49(42)46)41-23-13-14-24-44(41)55(45)39-21-11-4-12-22-39/h1-33,52H/b52-50-,53-33+,54-51- |
| InChIKey | FEEJFVNQECPAMQ-LYKQMDNGSA-N |
| XLogP | 13.38 |
| TPSA | 53.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.93 |
| LogP ≤ 5 | 13.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|