C64H44N4S — CID 170412651
7-benzo[b]carbazol-5-yl-N'-(9,9-dimethylfluorene-2-carboximidoyl)-N-[(3,5-diphenylphenyl)methylidene]dibenzothiophene-1-carboximidamide (PubChem CID 170412651) has the molecular formula C64H44N4S and a molecular weight of 901.15 g/mol. Its IUPAC name is 7-benzo[b]carbazol-5-yl-N'-(9,9-dimethylfluorene-2-carboximidoyl)-N-[(3,5-diphenylphenyl)methylidene]dibenzothiophene-1-carboximidamide.
| Compound Name | 7-benzo[b]carbazol-5-yl-N'-(9,9-dimethylfluorene-2-carboximidoyl)-N-[(3,5-diphenylphenyl)methylidene]dibenzothiophene-1-carboximidamide |
|---|---|
| PubChem CID | 170412651 |
| Molecular Formula | C64H44N4S |
| Molecular Weight | 901.15 g/mol |
| Exact Mass | 900.33 |
| IUPAC Name | 7-benzo[b]carbazol-5-yl-N'-(9,9-dimethylfluorene-2-carboximidoyl)-N-[(3,5-diphenylphenyl)methylidene]dibenzothiophene-1-carboximidamide |
| SMILES | [H]/N=C(/N=C(\N=C\c1cc(-c2ccccc2)cc(-c2ccccc2)c1)c1cccc2sc3cc(-n4c5ccccc5c5cc6ccccc6cc54)ccc3c12)c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C64H44N4S/c1-64(2)55-25-13-11-22-49(55)50-30-28-45(36-56(50)64)62(65)67-63(66-39-40-32-46(41-16-5-3-6-17-41)34-47(33-40)42-18-7-4-8-19-42)53-24-15-27-59-61(53)52-31-29-48(38-60(52)69-59)68-57-26-14-12-23-51(57)54-35-43-20-9-10-21-44(43)37-58(54)68/h3-39,65H,1-2H3/b65-62+,66-39+,67-63- |
| InChIKey | PJETYYMOVRJPBX-AODKVITASA-N |
| XLogP | 16.84 |
| TPSA | 53.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.15 |
| LogP ≤ 5 | 16.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|