C49H33N5 — CID 156624019
N-[(benzylideneamino)-[4-(5-phenylindolo[3,2-b]carbazol-11-yl)phenyl]methylidene]naphthalene-2-carboximidamide (PubChem CID 156624019) has the molecular formula C49H33N5 and a molecular weight of 691.84 g/mol. Its IUPAC name is N-[(benzylideneamino)-[4-(5-phenylindolo[3,2-b]carbazol-11-yl)phenyl]methylidene]naphthalene-2-carboximidamide.
| Compound Name | N-[(benzylideneamino)-[4-(5-phenylindolo[3,2-b]carbazol-11-yl)phenyl]methylidene]naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 156624019 |
| Molecular Formula | C49H33N5 |
| Molecular Weight | 691.84 g/mol |
| Exact Mass | 691.27 |
| IUPAC Name | N-[(benzylideneamino)-[4-(5-phenylindolo[3,2-b]carbazol-11-yl)phenyl]methylidene]naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(/N=C(\N=C\c1ccccc1)c1ccc(-n2c3ccccc3c3cc4c(cc32)c2ccccc2n4-c2ccccc2)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C49H33N5/c50-48(37-24-23-34-15-7-8-16-36(34)29-37)52-49(51-32-33-13-3-1-4-14-33)35-25-27-39(28-26-35)54-45-22-12-10-20-41(45)43-30-46-42(31-47(43)54)40-19-9-11-21-44(40)53(46)38-17-5-2-6-18-38/h1-32,50H/b50-48+,51-32+,52-49- |
| InChIKey | FJZNONCHVMAMRH-XQRUVDLZSA-N |
| XLogP | 11.93 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.84 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|