C42H29N5 — CID 145094324
N-[phenyl-[(12-phenyl-12,16-diazahexacyclo[11.11.0.02,11.03,8.015,23.017,22]tetracosa-1(13),2(11),3,5,7,9,14,17,19,21,23-undecaen-16-yl)amino]methylidene]benzenecarboximidamide (PubChem CID 145094324) has the molecular formula C42H29N5 and a molecular weight of 603.73 g/mol. Its IUPAC name is N-[phenyl-[(12-phenyl-12,16-diazahexacyclo[11.11.0.02,11.03,8.015,23.017,22]tetracosa-1(13),2(11),3,5,7,9,14,17,19,21,23-undecaen-16-yl)amino]methylidene]benzenecarboximidamide.
| Compound Name | N-[phenyl-[(12-phenyl-12,16-diazahexacyclo[11.11.0.02,11.03,8.015,23.017,22]tetracosa-1(13),2(11),3,5,7,9,14,17,19,21,23-undecaen-16-yl)amino]methylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 145094324 |
| Molecular Formula | C42H29N5 |
| Molecular Weight | 603.73 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | N-[phenyl-[(12-phenyl-12,16-diazahexacyclo[11.11.0.02,11.03,8.015,23.017,22]tetracosa-1(13),2(11),3,5,7,9,14,17,19,21,23-undecaen-16-yl)amino]methylidene]benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(/Nn1c2ccccc2c2cc3c4c5ccccc5ccc4n(-c4ccccc4)c3cc21)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H29N5/c43-41(29-15-4-1-5-16-29)44-42(30-17-6-2-7-18-30)45-47-36-23-13-12-22-33(36)34-26-35-38(27-39(34)47)46(31-19-8-3-9-20-31)37-25-24-28-14-10-11-21-32(28)40(35)37/h1-27H,(H2,43,44,45) |
| InChIKey | NKOCWFOBZQCDQO-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.73 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|