C56H40N4 — CID 90231146
4-[10-[(Z)-2-anilinoethenyl]benzo[c]carbazol-7-yl]-N-[(3,5-diphenylphenyl)-phenylmethylidene]benzenecarboximidamide (PubChem CID 90231146) has the molecular formula C56H40N4 and a molecular weight of 768.96 g/mol. Its IUPAC name is 4-[10-[(Z)-2-anilinoethenyl]benzo[c]carbazol-7-yl]-N-[(3,5-diphenylphenyl)-phenylmethylidene]benzenecarboximidamide.
| Compound Name | 4-[10-[(Z)-2-anilinoethenyl]benzo[c]carbazol-7-yl]-N-[(3,5-diphenylphenyl)-phenylmethylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 90231146 |
| Molecular Formula | C56H40N4 |
| Molecular Weight | 768.96 g/mol |
| Exact Mass | 768.33 |
| IUPAC Name | 4-[10-[(Z)-2-anilinoethenyl]benzo[c]carbazol-7-yl]-N-[(3,5-diphenylphenyl)-phenylmethylidene]benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(\c1ccccc1)c1cc(-c2ccccc2)cc(-c2ccccc2)c1)c1ccc(-n2c3ccc(/C=C\Nc4ccccc4)cc3c3c4ccccc4ccc32)cc1 |
| InChI | InChI=1S/C56H40N4/c57-56(59-55(43-20-9-3-10-21-43)47-37-45(40-15-5-1-6-16-40)36-46(38-47)41-17-7-2-8-18-41)44-26-29-49(30-27-44)60-52-31-25-39(33-34-58-48-22-11-4-12-23-48)35-51(52)54-50-24-14-13-19-42(50)28-32-53(54)60/h1-38,57-58H/b34-33-,57-56+,59-55+ |
| InChIKey | UKGMLAIERPNROK-ZJDJZISISA-N |
| XLogP | 14.22 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.96 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|