C42H33N5 — CID 145299401
N-[amino-(3-phenylphenyl)methylidene]-5-benzo[c]carbazol-7-ylpyridine-3-carboximidamide;toluene (PubChem CID 145299401) has the molecular formula C42H33N5 and a molecular weight of 607.76 g/mol. Its IUPAC name is N-[amino-(3-phenylphenyl)methylidene]-5-benzo[c]carbazol-7-ylpyridine-3-carboximidamide;toluene.
| Compound Name | N-[amino-(3-phenylphenyl)methylidene]-5-benzo[c]carbazol-7-ylpyridine-3-carboximidamide;toluene |
|---|---|
| PubChem CID | 145299401 |
| Molecular Formula | C42H33N5 |
| Molecular Weight | 607.76 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | N-[amino-(3-phenylphenyl)methylidene]-5-benzo[c]carbazol-7-ylpyridine-3-carboximidamide;toluene |
| SMILES | Cc1ccccc1.[H]/N=C(\N=C(/N)c1cccc(-c2ccccc2)c1)c1cncc(-n2c3ccccc3c3c4ccccc4ccc32)c1 |
| InChI | InChI=1S/C35H25N5.C7H8/c36-34(26-13-8-12-25(19-26)23-9-2-1-3-10-23)39-35(37)27-20-28(22-38-21-27)40-31-16-7-6-15-30(31)33-29-14-5-4-11-24(29)17-18-32(33)40;1-7-5-3-2-4-6-7/h1-22H,(H3,36,37,39);2-6H,1H3 |
| InChIKey | IMACCULXGPOIFG-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.76 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|