C42H37N5 — CID 145299539
N'-[(2E,4E)-5-amino-4-benzo[c]carbazol-7-yl-2-methylpenta-2,4-dienimidoyl]-4-phenylbenzenecarboximidamide;toluene (PubChem CID 145299539) has the molecular formula C42H37N5 and a molecular weight of 611.79 g/mol. Its IUPAC name is N'-[(2E,4E)-5-amino-4-benzo[c]carbazol-7-yl-2-methylpenta-2,4-dienimidoyl]-4-phenylbenzenecarboximidamide;toluene.
| Compound Name | N'-[(2E,4E)-5-amino-4-benzo[c]carbazol-7-yl-2-methylpenta-2,4-dienimidoyl]-4-phenylbenzenecarboximidamide;toluene |
|---|---|
| PubChem CID | 145299539 |
| Molecular Formula | C42H37N5 |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.30 |
| IUPAC Name | N'-[(2E,4E)-5-amino-4-benzo[c]carbazol-7-yl-2-methylpenta-2,4-dienimidoyl]-4-phenylbenzenecarboximidamide;toluene |
| SMILES | Cc1ccccc1.[H]/N=C(\N=C(/N)c1ccc(-c2ccccc2)cc1)C(/C)=C/C(=C\N)n1c2ccccc2c2c3ccccc3ccc21 |
| InChI | InChI=1S/C35H29N5.C7H8/c1-23(34(37)39-35(38)27-17-15-25(16-18-27)24-9-3-2-4-10-24)21-28(22-36)40-31-14-8-7-13-30(31)33-29-12-6-5-11-26(29)19-20-32(33)40;1-7-5-3-2-4-6-7/h2-22H,36H2,1H3,(H3,37,38,39);2-6H,1H3/b23-21+,28-22+; |
| InChIKey | SSVUXKKEUQZKKM-IZYZZDBMSA-N |
| XLogP | 9.70 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|