C36H24N4 — CID 166656564
N-[amino(phenyl)methylidene]-1-(1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaen-4-yl)naphthalene-2-carboximidamide (PubChem CID 166656564) has the molecular formula C36H24N4 and a molecular weight of 512.62 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-1-(1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaen-4-yl)naphthalene-2-carboximidamide.
| Compound Name | N-[amino(phenyl)methylidene]-1-(1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaen-4-yl)naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 166656564 |
| Molecular Formula | C36H24N4 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | N-[amino(phenyl)methylidene]-1-(1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaen-4-yl)naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N=C(/N)c1ccccc1)c1ccc2ccccc2c1-c1ccc2c3cccc4c5ccccc5n(c2c1)c43 |
| InChI | InChI=1S/C36H24N4/c37-35(23-10-2-1-3-11-23)39-36(38)30-20-17-22-9-4-5-12-25(22)33(30)24-18-19-27-29-15-8-14-28-26-13-6-7-16-31(26)40(34(28)29)32(27)21-24/h1-21H,(H3,37,38,39) |
| InChIKey | CSAWGDOSGHPPIL-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|