C56H39N5 — CID 142318896
N'-(benzenecarboximidoyl)-3,4-di(carbazol-9-yl)-2-(3,5-diphenylphenyl)benzenecarboximidamide (PubChem CID 142318896) has the molecular formula C56H39N5 and a molecular weight of 781.96 g/mol. Its IUPAC name is N'-(benzenecarboximidoyl)-3,4-di(carbazol-9-yl)-2-(3,5-diphenylphenyl)benzenecarboximidamide.
| Compound Name | N'-(benzenecarboximidoyl)-3,4-di(carbazol-9-yl)-2-(3,5-diphenylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 142318896 |
| Molecular Formula | C56H39N5 |
| Molecular Weight | 781.96 g/mol |
| Exact Mass | 781.32 |
| IUPAC Name | N'-(benzenecarboximidoyl)-3,4-di(carbazol-9-yl)-2-(3,5-diphenylphenyl)benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(\N)c1ccc(-n2c3ccccc3c3ccccc32)c(-n2c3ccccc3c3ccccc32)c1-c1cc(-c2ccccc2)cc(-c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C56H39N5/c57-55(39-22-8-3-9-23-39)59-56(58)47-32-33-52(60-48-28-14-10-24-43(48)44-25-11-15-29-49(44)60)54(61-50-30-16-12-26-45(50)46-27-13-17-31-51(46)61)53(47)42-35-40(37-18-4-1-5-19-37)34-41(36-42)38-20-6-2-7-21-38/h1-36H,(H3,57,58,59) |
| InChIKey | IAMSRIKWJYQHCW-UHFFFAOYSA-N |
| XLogP | 13.61 |
| TPSA | 72.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.96 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|