C57H40N4O2 — CID 156643264
8-(3-carbazol-9-yldibenzofuran-1-yl)-N'-(4-phenylbenzenecarboximidoyl)dibenzofuran-1-carboximidamide;toluene (PubChem CID 156643264) has the molecular formula C57H40N4O2 and a molecular weight of 812.97 g/mol. Its IUPAC name is 8-(3-carbazol-9-yldibenzofuran-1-yl)-N'-(4-phenylbenzenecarboximidoyl)dibenzofuran-1-carboximidamide;toluene.
| Compound Name | 8-(3-carbazol-9-yldibenzofuran-1-yl)-N'-(4-phenylbenzenecarboximidoyl)dibenzofuran-1-carboximidamide;toluene |
|---|---|
| PubChem CID | 156643264 |
| Molecular Formula | C57H40N4O2 |
| Molecular Weight | 812.97 g/mol |
| Exact Mass | 812.32 |
| IUPAC Name | 8-(3-carbazol-9-yldibenzofuran-1-yl)-N'-(4-phenylbenzenecarboximidoyl)dibenzofuran-1-carboximidamide;toluene |
| SMILES | Cc1ccccc1.[H]/N=C(/N=C(/N)c1cccc2oc3ccc(-c4cc(-n5c6ccccc6c6ccccc65)cc5oc6ccccc6c45)cc3c12)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C50H32N4O2.C7H8/c51-49(32-23-21-31(22-24-32)30-11-2-1-3-12-30)53-50(52)38-16-10-20-45-48(38)40-27-33(25-26-44(40)55-45)39-28-34(29-46-47(39)37-15-6-9-19-43(37)56-46)54-41-17-7-4-13-35(41)36-14-5-8-18-42(36)54;1-7-5-3-2-4-6-7/h1-29H,(H3,51,52,53);2-6H,1H3 |
| InChIKey | KJHTWBDRLRLCHF-UHFFFAOYSA-N |
| XLogP | 14.64 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.97 |
| LogP ≤ 5 | 14.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|