C51H31N3O2S — CID 159572337
N-[(3-dibenzothiophen-1-ylphenyl)-[(6-phenyldibenzofuran-3-yl)methylideneamino]methylidene]dibenzofuran-3-carboximidamide (PubChem CID 159572337) has the molecular formula C51H31N3O2S and a molecular weight of 749.90 g/mol. Its IUPAC name is N-[(3-dibenzothiophen-1-ylphenyl)-[(6-phenyldibenzofuran-3-yl)methylideneamino]methylidene]dibenzofuran-3-carboximidamide.
| Compound Name | N-[(3-dibenzothiophen-1-ylphenyl)-[(6-phenyldibenzofuran-3-yl)methylideneamino]methylidene]dibenzofuran-3-carboximidamide |
|---|---|
| PubChem CID | 159572337 |
| Molecular Formula | C51H31N3O2S |
| Molecular Weight | 749.90 g/mol |
| Exact Mass | 749.21 |
| IUPAC Name | N-[(3-dibenzothiophen-1-ylphenyl)-[(6-phenyldibenzofuran-3-yl)methylideneamino]methylidene]dibenzofuran-3-carboximidamide |
| SMILES | [H]/N=C(/N=C(/N=C/c1ccc2c(c1)oc1c(-c3ccccc3)cccc12)c1cccc(-c2cccc3sc4ccccc4c23)c1)c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C51H31N3O2S/c52-50(34-24-26-39-38-15-4-6-20-43(38)55-45(39)29-34)54-51(35-14-8-13-33(28-35)36-17-10-22-47-48(36)42-16-5-7-21-46(42)57-47)53-30-31-23-25-40-41-19-9-18-37(32-11-2-1-3-12-32)49(41)56-44(40)27-31/h1-30,52H/b52-50+,53-30+,54-51+ |
| InChIKey | IJMMWHHZGAKGBM-BNKSNQTLSA-N |
| XLogP | 14.08 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.90 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|