C45H31N3O — CID 176837504
N-[(benzylideneamino)-(3,5-diphenylphenyl)methylidene]-6-phenyldibenzofuran-4-carboximidamide (PubChem CID 176837504) has the molecular formula C45H31N3O and a molecular weight of 629.76 g/mol. Its IUPAC name is N-[(benzylideneamino)-(3,5-diphenylphenyl)methylidene]-6-phenyldibenzofuran-4-carboximidamide.
| Compound Name | N-[(benzylideneamino)-(3,5-diphenylphenyl)methylidene]-6-phenyldibenzofuran-4-carboximidamide |
|---|---|
| PubChem CID | 176837504 |
| Molecular Formula | C45H31N3O |
| Molecular Weight | 629.76 g/mol |
| Exact Mass | 629.25 |
| IUPAC Name | N-[(benzylideneamino)-(3,5-diphenylphenyl)methylidene]-6-phenyldibenzofuran-4-carboximidamide |
| SMILES | [H]/N=C(\N=C(/N=C/c1ccccc1)c1cc(-c2ccccc2)cc(-c2ccccc2)c1)c1cccc2c1oc1c(-c3ccccc3)cccc12 |
| InChI | InChI=1S/C45H31N3O/c46-44(41-26-14-25-40-39-24-13-23-38(42(39)49-43(40)41)34-21-11-4-12-22-34)48-45(47-30-31-15-5-1-6-16-31)37-28-35(32-17-7-2-8-18-32)27-36(29-37)33-19-9-3-10-20-33/h1-30,46H/b46-44-,47-30+,48-45- |
| InChIKey | RUZYLQMAEKGIMQ-DZHYDGORSA-N |
| XLogP | 11.48 |
| TPSA | 61.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.76 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|