C60H41N5 — CID 166751347
N'-(benzenecarboximidoyl)-3-phenyl-N-[[6'-(N-phenylanilino)spiro[fluorene-9,10'-indeno[1,2-b]indole]-5'-yl]methylidene]benzenecarboximidamide (PubChem CID 166751347) has the molecular formula C60H41N5 and a molecular weight of 832.02 g/mol. Its IUPAC name is N'-(benzenecarboximidoyl)-3-phenyl-N-[[6'-(N-phenylanilino)spiro[fluorene-9,10'-indeno[1,2-b]indole]-5'-yl]methylidene]benzenecarboximidamide.
| Compound Name | N'-(benzenecarboximidoyl)-3-phenyl-N-[[6'-(N-phenylanilino)spiro[fluorene-9,10'-indeno[1,2-b]indole]-5'-yl]methylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 166751347 |
| Molecular Formula | C60H41N5 |
| Molecular Weight | 832.02 g/mol |
| Exact Mass | 831.34 |
| IUPAC Name | N'-(benzenecarboximidoyl)-3-phenyl-N-[[6'-(N-phenylanilino)spiro[fluorene-9,10'-indeno[1,2-b]indole]-5'-yl]methylidene]benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(/N=C/n1c2c(c3cccc(N(c4ccccc4)c4ccccc4)c31)C1(c3ccccc3-c3ccccc31)c1ccccc1-2)c1cccc(-c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C60H41N5/c61-58(42-23-7-2-8-24-42)63-59(44-26-19-25-43(39-44)41-21-5-1-6-22-41)62-40-64-56-50(34-20-38-54(56)65(45-27-9-3-10-28-45)46-29-11-4-12-30-46)55-57(64)49-33-15-18-37-53(49)60(55)51-35-16-13-31-47(51)48-32-14-17-36-52(48)60/h1-40,61H/b61-58+,62-40+,63-59+ |
| InChIKey | AQWOCTUAVVMXGY-LKAHVXATSA-N |
| XLogP | 14.47 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.02 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|