C41H35N3 — CID 163720978
N'-(benzenecarboximidoyl)-N-benzylidene-12,12,13,13-tetramethylnaphtho[1,2-b]phenanthrene-2-carboximidamide (PubChem CID 163720978) has the molecular formula C41H35N3 and a molecular weight of 569.75 g/mol. Its IUPAC name is N'-(benzenecarboximidoyl)-N-benzylidene-12,12,13,13-tetramethylnaphtho[1,2-b]phenanthrene-2-carboximidamide.
| Compound Name | N'-(benzenecarboximidoyl)-N-benzylidene-12,12,13,13-tetramethylnaphtho[1,2-b]phenanthrene-2-carboximidamide |
|---|---|
| PubChem CID | 163720978 |
| Molecular Formula | C41H35N3 |
| Molecular Weight | 569.75 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | N'-(benzenecarboximidoyl)-N-benzylidene-12,12,13,13-tetramethylnaphtho[1,2-b]phenanthrene-2-carboximidamide |
| SMILES | [H]/N=C(/N=C(/N=C/c1ccccc1)c1ccc2ccc3cc4c(cc3c2c1)C(C)(C)C(C)(C)c1ccccc1-4)c1ccccc1 |
| InChI | InChI=1S/C41H35N3/c1-40(2)36-18-12-11-17-32(36)35-23-30-21-19-28-20-22-31(24-33(28)34(30)25-37(35)41(40,3)4)39(43-26-27-13-7-5-8-14-27)44-38(42)29-15-9-6-10-16-29/h5-26,42H,1-4H3/b42-38+,43-26+,44-39+ |
| InChIKey | DJPHTNIXWLSEOK-WYKNLLTOSA-N |
| XLogP | 10.12 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.75 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|