C57H46N6O — CID 130440050
3-[7-[3-[N-[(benzylideneamino)-phenylmethylidene]carbamimidoyl]phenyl]-9,9-dimethylxanthen-2-yl]-N'-(N-benzyl-C-phenylcarbonimidoyl)benzenecarboximidamide (PubChem CID 130440050) has the molecular formula C57H46N6O and a molecular weight of 831.04 g/mol. Its IUPAC name is 3-[7-[3-[N-[(benzylideneamino)-phenylmethylidene]carbamimidoyl]phenyl]-9,9-dimethylxanthen-2-yl]-N'-(N-benzyl-C-phenylcarbonimidoyl)benzenecarboximidamide.
| Compound Name | 3-[7-[3-[N-[(benzylideneamino)-phenylmethylidene]carbamimidoyl]phenyl]-9,9-dimethylxanthen-2-yl]-N'-(N-benzyl-C-phenylcarbonimidoyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 130440050 |
| Molecular Formula | C57H46N6O |
| Molecular Weight | 831.04 g/mol |
| Exact Mass | 830.37 |
| IUPAC Name | 3-[7-[3-[N-[(benzylideneamino)-phenylmethylidene]carbamimidoyl]phenyl]-9,9-dimethylxanthen-2-yl]-N'-(N-benzyl-C-phenylcarbonimidoyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N=C(/N=C/c1ccccc1)c1ccccc1)c1cccc(-c2ccc3c(c2)C(C)(C)c2cc(-c4cccc(/C(N)=N/C(=N/Cc5ccccc5)c5ccccc5)c4)ccc2O3)c1 |
| InChI | InChI=1S/C57H46N6O/c1-57(2)49-35-45(43-25-15-27-47(33-43)53(58)62-55(41-21-11-5-12-22-41)60-37-39-17-7-3-8-18-39)29-31-51(49)64-52-32-30-46(36-50(52)57)44-26-16-28-48(34-44)54(59)63-56(42-23-13-6-14-24-42)61-38-40-19-9-4-10-20-40/h3-37,58H,38H2,1-2H3,(H2,59,61,63)/b58-53-,60-37+,62-55- |
| InChIKey | GONDNYSJRPYAJU-KXCLDACDSA-N |
| XLogP | 12.70 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.04 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|