C48H38N6 — CID 176869686
N-[[[9,9-dimethyl-7-[3-[2-(pyridin-4-ylamino)benzenecarboximidoyl]phenyl]fluoren-2-yl]methylideneamino]-phenylmethylidene]benzenecarboximidamide (PubChem CID 176869686) has the molecular formula C48H38N6 and a molecular weight of 698.87 g/mol. Its IUPAC name is N-[[[9,9-dimethyl-7-[3-[2-(pyridin-4-ylamino)benzenecarboximidoyl]phenyl]fluoren-2-yl]methylideneamino]-phenylmethylidene]benzenecarboximidamide.
| Compound Name | N-[[[9,9-dimethyl-7-[3-[2-(pyridin-4-ylamino)benzenecarboximidoyl]phenyl]fluoren-2-yl]methylideneamino]-phenylmethylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 176869686 |
| Molecular Formula | C48H38N6 |
| Molecular Weight | 698.87 g/mol |
| Exact Mass | 698.32 |
| IUPAC Name | N-[[[9,9-dimethyl-7-[3-[2-(pyridin-4-ylamino)benzenecarboximidoyl]phenyl]fluoren-2-yl]methylideneamino]-phenylmethylidene]benzenecarboximidamide |
| SMILES | [H]/N=C(/c1cccc(-c2ccc3c(c2)C(C)(C)c2cc(/C=N/C(=N/C(=N/[H])c4ccccc4)c4ccccc4)ccc2-3)c1)c1ccccc1Nc1ccncc1 |
| InChI | InChI=1S/C48H38N6/c1-48(2)42-28-32(31-52-47(34-14-7-4-8-15-34)54-46(50)33-12-5-3-6-13-33)20-22-39(42)40-23-21-36(30-43(40)48)35-16-11-17-37(29-35)45(49)41-18-9-10-19-44(41)53-38-24-26-51-27-25-38/h3-31,49-50H,1-2H3,(H,51,53)/b49-45-,50-46+,52-31+,54-47+ |
| InChIKey | TWKNLMRKNRGWRH-WDHLIXAYSA-N |
| XLogP | 11.11 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.87 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|