C43H33N5 — CID 154596550
2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluorene-3-carboximidoyl]-N-phenylaniline (PubChem CID 154596550) has the molecular formula C43H33N5 and a molecular weight of 619.77 g/mol. Its IUPAC name is 2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluorene-3-carboximidoyl]-N-phenylaniline.
| Compound Name | 2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluorene-3-carboximidoyl]-N-phenylaniline |
|---|---|
| PubChem CID | 154596550 |
| Molecular Formula | C43H33N5 |
| Molecular Weight | 619.77 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | 2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluorene-3-carboximidoyl]-N-phenylaniline |
| SMILES | [H]/N=C(/c1ccc2c(c1)-c1cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc1C2(C)C)c1ccccc1Nc1ccccc1 |
| InChI | InChI=1S/C43H33N5/c1-43(2)36-24-22-30(39(44)33-20-12-13-21-38(33)45-32-18-10-5-11-19-32)26-34(36)35-27-31(23-25-37(35)43)42-47-40(28-14-6-3-7-15-28)46-41(48-42)29-16-8-4-9-17-29/h3-27,44-45H,1-2H3/b44-39- |
| InChIKey | YKRKIGFYVXOCNR-MLQFJZEUSA-N |
| XLogP | 10.34 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.77 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|