C49H37N5 — CID 154596750
2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluorene-3-carboximidoyl]-N,4-diphenylaniline (PubChem CID 154596750) has the molecular formula C49H37N5 and a molecular weight of 695.87 g/mol. Its IUPAC name is 2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluorene-3-carboximidoyl]-N,4-diphenylaniline.
| Compound Name | 2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluorene-3-carboximidoyl]-N,4-diphenylaniline |
|---|---|
| PubChem CID | 154596750 |
| Molecular Formula | C49H37N5 |
| Molecular Weight | 695.87 g/mol |
| Exact Mass | 695.30 |
| IUPAC Name | 2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluorene-3-carboximidoyl]-N,4-diphenylaniline |
| SMILES | [H]/N=C(\c1ccc2c(c1)-c1cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc1C2(C)C)c1cc(-c2ccccc2)ccc1Nc1ccccc1 |
| InChI | InChI=1S/C49H37N5/c1-49(2)42-26-23-36(45(50)41-29-35(32-15-7-3-8-16-32)25-28-44(41)51-38-21-13-6-14-22-38)30-39(42)40-31-37(24-27-43(40)49)48-53-46(33-17-9-4-10-18-33)52-47(54-48)34-19-11-5-12-20-34/h3-31,50-51H,1-2H3/b50-45+ |
| InChIKey | SRVXMIMVMSRTTQ-CWVPRGGHSA-N |
| XLogP | 12.01 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.87 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|