C45H30N6O2 — CID 154596680
N-[2-[3-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzo-p-dioxin-2-yl]benzenecarboximidoyl]phenyl]pyridin-4-amine (PubChem CID 154596680) has the molecular formula C45H30N6O2 and a molecular weight of 686.78 g/mol. Its IUPAC name is N-[2-[3-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzo-p-dioxin-2-yl]benzenecarboximidoyl]phenyl]pyridin-4-amine.
| Compound Name | N-[2-[3-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzo-p-dioxin-2-yl]benzenecarboximidoyl]phenyl]pyridin-4-amine |
|---|---|
| PubChem CID | 154596680 |
| Molecular Formula | C45H30N6O2 |
| Molecular Weight | 686.78 g/mol |
| Exact Mass | 686.24 |
| IUPAC Name | N-[2-[3-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzo-p-dioxin-2-yl]benzenecarboximidoyl]phenyl]pyridin-4-amine |
| SMILES | [H]/N=C(\c1cccc(-c2ccc3c(c2)Oc2cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc2O3)c1)c1ccccc1Nc1ccncc1 |
| InChI | InChI=1S/C45H30N6O2/c46-42(36-16-7-8-17-37(36)48-35-22-24-47-25-23-35)33-15-9-14-31(26-33)32-18-20-38-40(27-32)53-41-28-34(19-21-39(41)52-38)45-50-43(29-10-3-1-4-11-29)49-44(51-45)30-12-5-2-6-13-30/h1-28,46H,(H,47,48)/b46-42+ |
| InChIKey | RDAZPPAZPCAHOO-IFJLIMJSSA-N |
| XLogP | 10.99 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.78 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|