C44H29N5O — CID 154596585
1-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-carboximidoyl]-N-phenylnaphthalen-2-amine (PubChem CID 154596585) has the molecular formula C44H29N5O and a molecular weight of 643.75 g/mol. Its IUPAC name is 1-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-carboximidoyl]-N-phenylnaphthalen-2-amine.
| Compound Name | 1-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-carboximidoyl]-N-phenylnaphthalen-2-amine |
|---|---|
| PubChem CID | 154596585 |
| Molecular Formula | C44H29N5O |
| Molecular Weight | 643.75 g/mol |
| Exact Mass | 643.24 |
| IUPAC Name | 1-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-carboximidoyl]-N-phenylnaphthalen-2-amine |
| SMILES | [H]/N=C(\c1ccc2oc3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3c2c1)c1c(Nc2ccccc2)ccc2ccccc12 |
| InChI | InChI=1S/C44H29N5O/c45-41(40-34-19-11-10-12-28(34)20-23-37(40)46-33-17-8-3-9-18-33)31-21-24-38-35(26-31)36-27-32(22-25-39(36)50-38)44-48-42(29-13-4-1-5-14-29)47-43(49-44)30-15-6-2-7-16-30/h1-27,45-46H/b45-41+ |
| InChIKey | JDNZPKHQUMYFLY-LYMKOHMFSA-N |
| XLogP | 11.08 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.75 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|