C45H27N5O2 — CID 146666271
2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-quinolin-2-yldibenzo-p-dioxin-2-yl]quinoline (PubChem CID 146666271) has the molecular formula C45H27N5O2 and a molecular weight of 669.74 g/mol. Its IUPAC name is 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-quinolin-2-yldibenzo-p-dioxin-2-yl]quinoline.
| Compound Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-quinolin-2-yldibenzo-p-dioxin-2-yl]quinoline |
|---|---|
| PubChem CID | 146666271 |
| Molecular Formula | C45H27N5O2 |
| Molecular Weight | 669.74 g/mol |
| Exact Mass | 669.22 |
| IUPAC Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-quinolin-2-yldibenzo-p-dioxin-2-yl]quinoline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)Oc3cc(-c5ccc6ccccc6n5)c(-c5ccc6ccccc6n5)cc3O4)n2)cc1 |
| InChI | InChI=1S/C45H27N5O2/c1-3-13-30(14-4-1)43-48-44(31-15-5-2-6-16-31)50-45(49-43)32-21-24-39-40(25-32)52-42-27-34(38-23-20-29-12-8-10-18-36(29)47-38)33(26-41(42)51-39)37-22-19-28-11-7-9-17-35(28)46-37/h1-27H |
| InChIKey | AXQKFPHZPOHSGV-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 82.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.74 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |