C51H34N4OS — CID 169010683
N'-(benzenecarboximidoyl)-N-benzylidene-9-[8-(2-phenylanilino)dibenzothiophen-2-yl]dibenzofuran-4-carboximidamide (PubChem CID 169010683) has the molecular formula C51H34N4OS and a molecular weight of 750.93 g/mol. Its IUPAC name is N'-(benzenecarboximidoyl)-N-benzylidene-9-[8-(2-phenylanilino)dibenzothiophen-2-yl]dibenzofuran-4-carboximidamide.
| Compound Name | N'-(benzenecarboximidoyl)-N-benzylidene-9-[8-(2-phenylanilino)dibenzothiophen-2-yl]dibenzofuran-4-carboximidamide |
|---|---|
| PubChem CID | 169010683 |
| Molecular Formula | C51H34N4OS |
| Molecular Weight | 750.93 g/mol |
| Exact Mass | 750.25 |
| IUPAC Name | N'-(benzenecarboximidoyl)-N-benzylidene-9-[8-(2-phenylanilino)dibenzothiophen-2-yl]dibenzofuran-4-carboximidamide |
| SMILES | [H]/N=C(/N=C(/N=C/c1ccccc1)c1cccc2c1oc1cccc(-c3ccc4sc5ccc(Nc6ccccc6-c6ccccc6)cc5c4c3)c12)c1ccccc1 |
| InChI | InChI=1S/C51H34N4OS/c52-50(35-18-8-3-9-19-35)55-51(53-32-33-14-4-1-5-15-33)41-23-12-22-40-48-39(21-13-25-45(48)56-49(40)41)36-26-28-46-42(30-36)43-31-37(27-29-47(43)57-46)54-44-24-11-10-20-38(44)34-16-6-2-7-17-34/h1-32,52,54H/b52-50+,53-32+,55-51+ |
| InChIKey | IIEZJPCSIAIVCJ-SAUJJJOHSA-N |
| XLogP | 13.92 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.93 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|