C43H39N3 — CID 145110712
N-[amino(phenyl)methylidene]-N'-benzyl-3-[(2E,4E)-5-(9,9-dimethylfluoren-1-yl)hepta-2,4,6-trien-3-yl]benzenecarboximidamide (PubChem CID 145110712) has the molecular formula C43H39N3 and a molecular weight of 597.81 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-N'-benzyl-3-[(2E,4E)-5-(9,9-dimethylfluoren-1-yl)hepta-2,4,6-trien-3-yl]benzenecarboximidamide.
| Compound Name | N-[amino(phenyl)methylidene]-N'-benzyl-3-[(2E,4E)-5-(9,9-dimethylfluoren-1-yl)hepta-2,4,6-trien-3-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145110712 |
| Molecular Formula | C43H39N3 |
| Molecular Weight | 597.81 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | N-[amino(phenyl)methylidene]-N'-benzyl-3-[(2E,4E)-5-(9,9-dimethylfluoren-1-yl)hepta-2,4,6-trien-3-yl]benzenecarboximidamide |
| SMILES | C=C/C(=C\C(=C/C)c1cccc(C(/N=C(\N)c2ccccc2)=N\Cc2ccccc2)c1)c1cccc2c1C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C43H39N3/c1-5-31(27-32(6-2)36-24-16-25-38-37-23-13-14-26-39(37)43(3,4)40(36)38)34-21-15-22-35(28-34)42(45-29-30-17-9-7-10-18-30)46-41(44)33-19-11-8-12-20-33/h5-28H,2,29H2,1,3-4H3,(H2,44,45,46)/b31-5+,32-27+ |
| InChIKey | ANCXNOVXOJCMMM-CNQILONYSA-N |
| XLogP | 10.02 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.81 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|