C58H44N4 — CID 121323520
4-phenyl-N'-[C-phenyl-N-[[3-[(2,9,9-triphenylfluoren-3-yl)amino]phenyl]methyl]carbonimidoyl]benzenecarboximidamide (PubChem CID 121323520) has the molecular formula C58H44N4 and a molecular weight of 797.02 g/mol. Its IUPAC name is 4-phenyl-N'-[C-phenyl-N-[[3-[(2,9,9-triphenylfluoren-3-yl)amino]phenyl]methyl]carbonimidoyl]benzenecarboximidamide.
| Compound Name | 4-phenyl-N'-[C-phenyl-N-[[3-[(2,9,9-triphenylfluoren-3-yl)amino]phenyl]methyl]carbonimidoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 121323520 |
| Molecular Formula | C58H44N4 |
| Molecular Weight | 797.02 g/mol |
| Exact Mass | 796.36 |
| IUPAC Name | 4-phenyl-N'-[C-phenyl-N-[[3-[(2,9,9-triphenylfluoren-3-yl)amino]phenyl]methyl]carbonimidoyl]benzenecarboximidamide |
| SMILES | N/C(=N\C(=N/Cc1cccc(Nc2cc3c(cc2-c2ccccc2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)c1)c1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C58H44N4/c59-56(45-35-33-43(34-36-45)42-20-6-1-7-21-42)62-57(46-24-10-3-11-25-46)60-40-41-19-18-30-49(37-41)61-55-39-52-50-31-16-17-32-53(50)58(47-26-12-4-13-27-47,48-28-14-5-15-29-48)54(52)38-51(55)44-22-8-2-9-23-44/h1-39,61H,40H2,(H2,59,60,62) |
| InChIKey | GBALXXSQLKBFKU-UHFFFAOYSA-N |
| XLogP | 13.48 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.02 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|