C51H33N3O2 — CID 176831362
N-[(dibenzofuran-1-ylmethylideneamino)-[3-phenyl-5-(3-phenylphenyl)phenyl]methylidene]dibenzofuran-4-carboximidamide (PubChem CID 176831362) has the molecular formula C51H33N3O2 and a molecular weight of 719.84 g/mol. Its IUPAC name is N-[(dibenzofuran-1-ylmethylideneamino)-[3-phenyl-5-(3-phenylphenyl)phenyl]methylidene]dibenzofuran-4-carboximidamide.
| Compound Name | N-[(dibenzofuran-1-ylmethylideneamino)-[3-phenyl-5-(3-phenylphenyl)phenyl]methylidene]dibenzofuran-4-carboximidamide |
|---|---|
| PubChem CID | 176831362 |
| Molecular Formula | C51H33N3O2 |
| Molecular Weight | 719.84 g/mol |
| Exact Mass | 719.26 |
| IUPAC Name | N-[(dibenzofuran-1-ylmethylideneamino)-[3-phenyl-5-(3-phenylphenyl)phenyl]methylidene]dibenzofuran-4-carboximidamide |
| SMILES | [H]/N=C(\N=C(/N=C/c1cccc2oc3ccccc3c12)c1cc(-c2ccccc2)cc(-c2cccc(-c3ccccc3)c2)c1)c1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C51H33N3O2/c52-50(44-24-13-23-42-41-21-7-9-25-45(41)56-49(42)44)54-51(53-32-37-20-12-27-47-48(37)43-22-8-10-26-46(43)55-47)40-30-38(34-16-5-2-6-17-34)29-39(31-40)36-19-11-18-35(28-36)33-14-3-1-4-15-33/h1-32,52H/b52-50-,53-32+,54-51- |
| InChIKey | POLZAJXYLKDRBD-LOKBBMDQSA-N |
| XLogP | 13.38 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.84 |
| LogP ≤ 5 | 13.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|