C37H23N3OS — CID 177256907
N-[(naphtho[1,2-b][1]benzothiol-1-ylmethylideneamino)-phenylmethylidene]dibenzofuran-1-carboximidamide (PubChem CID 177256907) has the molecular formula C37H23N3OS and a molecular weight of 557.68 g/mol. Its IUPAC name is N-[(naphtho[1,2-b][1]benzothiol-1-ylmethylideneamino)-phenylmethylidene]dibenzofuran-1-carboximidamide.
| Compound Name | N-[(naphtho[1,2-b][1]benzothiol-1-ylmethylideneamino)-phenylmethylidene]dibenzofuran-1-carboximidamide |
|---|---|
| PubChem CID | 177256907 |
| Molecular Formula | C37H23N3OS |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | N-[(naphtho[1,2-b][1]benzothiol-1-ylmethylideneamino)-phenylmethylidene]dibenzofuran-1-carboximidamide |
| SMILES | [H]/N=C(/N=C(/N=C/c1cccc2ccc3c4ccccc4sc3c12)c1ccccc1)c1cccc2oc3ccccc3c12 |
| InChI | InChI=1S/C37H23N3OS/c38-36(29-16-9-18-31-34(29)28-15-4-6-17-30(28)41-31)40-37(24-10-2-1-3-11-24)39-22-25-13-8-12-23-20-21-27-26-14-5-7-19-32(26)42-35(27)33(23)25/h1-22,38H/b38-36+,39-22+,40-37+ |
| InChIKey | JHICQKXJDPTMTR-HBQDZBEXSA-N |
| XLogP | 10.00 |
| TPSA | 61.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|