C33H22BrN3 — CID 171457310
4-bromo-N-[(phenanthren-9-ylmethylideneamino)-phenylmethylidene]naphthalene-1-carboximidamide (PubChem CID 171457310) has the molecular formula C33H22BrN3 and a molecular weight of 540.46 g/mol. Its IUPAC name is 4-bromo-N-[(phenanthren-9-ylmethylideneamino)-phenylmethylidene]naphthalene-1-carboximidamide.
| Compound Name | 4-bromo-N-[(phenanthren-9-ylmethylideneamino)-phenylmethylidene]naphthalene-1-carboximidamide |
|---|---|
| PubChem CID | 171457310 |
| Molecular Formula | C33H22BrN3 |
| Molecular Weight | 540.46 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | 4-bromo-N-[(phenanthren-9-ylmethylideneamino)-phenylmethylidene]naphthalene-1-carboximidamide |
| SMILES | [H]/N=C(/N=C(/N=C/c1cc2ccccc2c2ccccc12)c1ccccc1)c1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C33H22BrN3/c34-31-19-18-30(28-16-8-9-17-29(28)31)32(35)37-33(22-10-2-1-3-11-22)36-21-24-20-23-12-4-5-13-25(23)27-15-7-6-14-26(24)27/h1-21,35H/b35-32+,36-21+,37-33+ |
| InChIKey | LKVINWWNUGFSQD-UPLUKKSCSA-N |
| XLogP | 8.80 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.46 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|