C45H34N4Si — CID 169044297
N-[phenyl-[(3-triphenylsilylcarbazol-9-yl)methylideneamino]methylidene]benzenecarboximidamide (PubChem CID 169044297) has the molecular formula C45H34N4Si and a molecular weight of 658.88 g/mol. Its IUPAC name is N-[phenyl-[(3-triphenylsilylcarbazol-9-yl)methylideneamino]methylidene]benzenecarboximidamide.
| Compound Name | N-[phenyl-[(3-triphenylsilylcarbazol-9-yl)methylideneamino]methylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 169044297 |
| Molecular Formula | C45H34N4Si |
| Molecular Weight | 658.88 g/mol |
| Exact Mass | 658.26 |
| IUPAC Name | N-[phenyl-[(3-triphenylsilylcarbazol-9-yl)methylideneamino]methylidene]benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(/N=C/n1c2ccccc2c2cc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)ccc21)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H34N4Si/c46-44(34-18-6-1-7-19-34)48-45(35-20-8-2-9-21-35)47-33-49-42-29-17-16-28-40(42)41-32-39(30-31-43(41)49)50(36-22-10-3-11-23-36,37-24-12-4-13-25-37)38-26-14-5-15-27-38/h1-33,46H/b46-44+,47-33+,48-45+ |
| InChIKey | AOTYFJXHCIQCLT-GSKNZZNJSA-N |
| XLogP | 7.52 |
| TPSA | 53.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.88 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|