C45H33N3O — CID 170248532
N'-(benzenecarboximidoyl)-N-[(9-cyclohexa-2,4-dien-1-yldibenzofuran-1-yl)methylidene]-4-(4-phenylphenyl)benzenecarboximidamide (PubChem CID 170248532) has the molecular formula C45H33N3O and a molecular weight of 631.78 g/mol. Its IUPAC name is N'-(benzenecarboximidoyl)-N-[(9-cyclohexa-2,4-dien-1-yldibenzofuran-1-yl)methylidene]-4-(4-phenylphenyl)benzenecarboximidamide.
| Compound Name | N'-(benzenecarboximidoyl)-N-[(9-cyclohexa-2,4-dien-1-yldibenzofuran-1-yl)methylidene]-4-(4-phenylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 170248532 |
| Molecular Formula | C45H33N3O |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.26 |
| IUPAC Name | N'-(benzenecarboximidoyl)-N-[(9-cyclohexa-2,4-dien-1-yldibenzofuran-1-yl)methylidene]-4-(4-phenylphenyl)benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(/N=C\c1cccc2oc3cccc(C4C=CC=CC4)c3c12)c1ccc(-c2ccc(-c3ccccc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C45H33N3O/c46-44(36-16-8-3-9-17-36)48-45(37-28-26-34(27-29-37)33-24-22-32(23-25-33)31-12-4-1-5-13-31)47-30-38-18-10-20-40-42(38)43-39(19-11-21-41(43)49-40)35-14-6-2-7-15-35/h1-14,16-30,35,46H,15H2/b46-44+,47-30-,48-45+ |
| InChIKey | NFMTTZOBNMJFBD-JMMYMUDFSA-N |
| XLogP | 11.41 |
| TPSA | 61.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|