C46H36N2 — CID 155180515
(E)-3-[3-(7,8-dihydrophenanthren-3-yl)-5-(1H-indol-5-yl)phenyl]-1-phenyl-N-(1-phenylethenyl)but-2-en-1-imine (PubChem CID 155180515) has the molecular formula C46H36N2 and a molecular weight of 616.81 g/mol. Its IUPAC name is (E)-3-[3-(7,8-dihydrophenanthren-3-yl)-5-(1H-indol-5-yl)phenyl]-1-phenyl-N-(1-phenylethenyl)but-2-en-1-imine.
| Compound Name | (E)-3-[3-(7,8-dihydrophenanthren-3-yl)-5-(1H-indol-5-yl)phenyl]-1-phenyl-N-(1-phenylethenyl)but-2-en-1-imine |
|---|---|
| PubChem CID | 155180515 |
| Molecular Formula | C46H36N2 |
| Molecular Weight | 616.81 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | (E)-3-[3-(7,8-dihydrophenanthren-3-yl)-5-(1H-indol-5-yl)phenyl]-1-phenyl-N-(1-phenylethenyl)but-2-en-1-imine |
| SMILES | C=C(/N=C(/C=C(\C)c1cc(-c2ccc3[nH]ccc3c2)cc(-c2ccc3ccc4c(c3c2)C=CCC4)c1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H36N2/c1-31(25-46(36-14-7-4-8-15-36)48-32(2)33-11-5-3-6-12-33)40-27-41(37-21-22-45-39(26-37)23-24-47-45)29-42(28-40)38-20-19-35-18-17-34-13-9-10-16-43(34)44(35)30-38/h3-8,10-12,14-30,47H,2,9,13H2,1H3/b31-25+,48-46- |
| InChIKey | PMXCKBXNIODTCD-WYUNGLGLSA-N |
| XLogP | 12.18 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.81 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|