C14H12B2 — CID 175958969
CID 175958969 (PubChem CID 175958969) has the molecular formula C14H12B2 and a molecular weight of 201.87 g/mol.
| Compound Name | CID 175958969 |
|---|---|
| PubChem CID | 175958969 |
| Molecular Formula | C14H12B2 |
| Molecular Weight | 201.87 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | — |
| SMILES | C1=Cc2c(ccc3ccccc23)CC1.[B].[B] |
| InChI | InChI=1S/C14H12.2B/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;;/h1,3-5,7-10H,2,6H2;; |
| InChIKey | JKVANGKNZNFQPI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.87 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|