C14H11B — CID 144989571
CID 144989571 (PubChem CID 144989571) has the molecular formula C14H11B and a molecular weight of 190.05 g/mol.
| Compound Name | CID 144989571 |
|---|---|
| PubChem CID | 144989571 |
| Molecular Formula | C14H11B |
| Molecular Weight | 190.05 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | — |
| SMILES | [B]c1c2c(cc3ccccc13)CCC=C2 |
| InChI | InChI=1S/C14H11B/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1,3-5,7-9H,2,6H2 |
| InChIKey | FLNTYOJCEFSXLM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.05 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|