C21H18 — CID 142428670
7-methyl-10-phenyl-1,2-dihydroanthracene (PubChem CID 142428670) has the molecular formula C21H18 and a molecular weight of 270.38 g/mol. Its IUPAC name is 7-methyl-10-phenyl-1,2-dihydroanthracene.
| Compound Name | 7-methyl-10-phenyl-1,2-dihydroanthracene |
|---|---|
| PubChem CID | 142428670 |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 7-methyl-10-phenyl-1,2-dihydroanthracene |
| SMILES | Cc1ccc2c(-c3ccccc3)c3c(cc2c1)CCC=C3 |
| InChI | InChI=1S/C21H18/c1-15-11-12-20-18(13-15)14-17-9-5-6-10-19(17)21(20)16-7-3-2-4-8-16/h2-4,6-8,10-14H,5,9H2,1H3 |
| InChIKey | RVNWZTUTBKBNLR-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |