C53H45N — CID 89083897
N-(4-tert-butylphenyl)-N-(4-methylphenyl)-5,6,8-triphenyl-11,12-dihydrotriphenylen-2-amine (PubChem CID 89083897) has the molecular formula C53H45N and a molecular weight of 695.95 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N-(4-methylphenyl)-5,6,8-triphenyl-11,12-dihydrotriphenylen-2-amine.
| Compound Name | N-(4-tert-butylphenyl)-N-(4-methylphenyl)-5,6,8-triphenyl-11,12-dihydrotriphenylen-2-amine |
|---|---|
| PubChem CID | 89083897 |
| Molecular Formula | C53H45N |
| Molecular Weight | 695.95 g/mol |
| Exact Mass | 695.36 |
| IUPAC Name | N-(4-tert-butylphenyl)-N-(4-methylphenyl)-5,6,8-triphenyl-11,12-dihydrotriphenylen-2-amine |
| SMILES | Cc1ccc(N(c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)c2c(c4c(-c5ccccc5)cc(-c5ccccc5)c(-c5ccccc5)c43)C=CCC2)cc1 |
| InChI | InChI=1S/C53H45N/c1-36-24-28-41(29-25-36)54(42-30-26-40(27-31-42)53(2,3)4)43-32-33-46-49(34-43)44-22-14-15-23-45(44)51-48(38-18-10-6-11-19-38)35-47(37-16-8-5-9-17-37)50(52(46)51)39-20-12-7-13-21-39/h5-13,15-21,23-35H,14,22H2,1-4H3 |
| InChIKey | NSGRLJZKHIUBEM-UHFFFAOYSA-N |
| XLogP | 15.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.95 |
| LogP ≤ 5 | 15.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|