C56H51N — CID 89083639
N-(4-tert-butylcyclohexa-1,3-dien-1-yl)-N-(4-tert-butylphenyl)-5,7,8-triphenyltriphenylen-2-amine (PubChem CID 89083639) has the molecular formula C56H51N and a molecular weight of 738.03 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexa-1,3-dien-1-yl)-N-(4-tert-butylphenyl)-5,7,8-triphenyltriphenylen-2-amine.
| Compound Name | N-(4-tert-butylcyclohexa-1,3-dien-1-yl)-N-(4-tert-butylphenyl)-5,7,8-triphenyltriphenylen-2-amine |
|---|---|
| PubChem CID | 89083639 |
| Molecular Formula | C56H51N |
| Molecular Weight | 738.03 g/mol |
| Exact Mass | 737.40 |
| IUPAC Name | N-(4-tert-butylcyclohexa-1,3-dien-1-yl)-N-(4-tert-butylphenyl)-5,7,8-triphenyltriphenylen-2-amine |
| SMILES | CC(C)(C)C1=CC=C(N(c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)c2ccccc2c2c(-c4ccccc4)c(-c4ccccc4)cc(-c4ccccc4)c32)CC1 |
| InChI | InChI=1S/C56H51N/c1-55(2,3)41-26-30-43(31-27-41)57(44-32-28-42(29-33-44)56(4,5)6)45-34-35-48-51(36-45)46-24-16-17-25-47(46)54-52(40-22-14-9-15-23-40)49(38-18-10-7-11-19-38)37-50(53(48)54)39-20-12-8-13-21-39/h7-28,30-32,34-37H,29,33H2,1-6H3 |
| InChIKey | KZTCFMBZPQDABV-UHFFFAOYSA-N |
| XLogP | 16.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.03 |
| LogP ≤ 5 | 16.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|