C70H62N2 — CID 89152592
6-N-(4-tert-butylcyclohexa-1,3-dien-1-yl)-2-N-(4-tert-butylphenyl)-2-N,6-N-diphenyl-9,10-bis(4-phenylphenyl)anthracene-2,6-diamine (PubChem CID 89152592) has the molecular formula C70H62N2 and a molecular weight of 931.28 g/mol. Its IUPAC name is 6-N-(4-tert-butylcyclohexa-1,3-dien-1-yl)-2-N-(4-tert-butylphenyl)-2-N,6-N-diphenyl-9,10-bis(4-phenylphenyl)anthracene-2,6-diamine.
| Compound Name | 6-N-(4-tert-butylcyclohexa-1,3-dien-1-yl)-2-N-(4-tert-butylphenyl)-2-N,6-N-diphenyl-9,10-bis(4-phenylphenyl)anthracene-2,6-diamine |
|---|---|
| PubChem CID | 89152592 |
| Molecular Formula | C70H62N2 |
| Molecular Weight | 931.28 g/mol |
| Exact Mass | 930.49 |
| IUPAC Name | 6-N-(4-tert-butylcyclohexa-1,3-dien-1-yl)-2-N-(4-tert-butylphenyl)-2-N,6-N-diphenyl-9,10-bis(4-phenylphenyl)anthracene-2,6-diamine |
| SMILES | CC(C)(C)C1=CC=C(N(c2ccccc2)c2ccc3c(-c4ccc(-c5ccccc5)cc4)c4cc(N(c5ccccc5)c5ccc(C(C)(C)C)cc5)ccc4c(-c4ccc(-c5ccccc5)cc4)c3c2)CC1 |
| InChI | InChI=1S/C70H62N2/c1-69(2,3)55-35-39-59(40-36-55)71(57-23-15-9-16-24-57)61-43-45-63-65(47-61)67(53-31-27-51(28-32-53)49-19-11-7-12-20-49)64-46-44-62(48-66(64)68(63)54-33-29-52(30-34-54)50-21-13-8-14-22-50)72(58-25-17-10-18-26-58)60-41-37-56(38-42-60)70(4,5)6/h7-37,39-41,43-48H,38,42H2,1-6H3 |
| InChIKey | CYGFBJCKRVAYBW-UHFFFAOYSA-N |
| XLogP | 20.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.28 |
| LogP ≤ 5 | 20.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|