C60H52N2 — CID 170691684
9,10-bis[4-(2-methylbut-3-en-2-yl)phenyl]-2-N,2-N,6-N,6-N-tetraphenylanthracene-2,6-diamine (PubChem CID 170691684) has the molecular formula C60H52N2 and a molecular weight of 801.09 g/mol. Its IUPAC name is 9,10-bis[4-(2-methylbut-3-en-2-yl)phenyl]-2-N,2-N,6-N,6-N-tetraphenylanthracene-2,6-diamine.
| Compound Name | 9,10-bis[4-(2-methylbut-3-en-2-yl)phenyl]-2-N,2-N,6-N,6-N-tetraphenylanthracene-2,6-diamine |
|---|---|
| PubChem CID | 170691684 |
| Molecular Formula | C60H52N2 |
| Molecular Weight | 801.09 g/mol |
| Exact Mass | 800.41 |
| IUPAC Name | 9,10-bis[4-(2-methylbut-3-en-2-yl)phenyl]-2-N,2-N,6-N,6-N-tetraphenylanthracene-2,6-diamine |
| SMILES | C=CC(C)(C)c1ccc(-c2c3ccc(N(c4ccccc4)c4ccccc4)cc3c(-c3ccc(C(C)(C)C=C)cc3)c3ccc(N(c4ccccc4)c4ccccc4)cc23)cc1 |
| InChI | InChI=1S/C60H52N2/c1-7-59(3,4)45-33-29-43(30-34-45)57-53-39-37-52(62(49-25-17-11-18-26-49)50-27-19-12-20-28-50)42-56(53)58(44-31-35-46(36-32-44)60(5,6)8-2)54-40-38-51(41-55(54)57)61(47-21-13-9-14-22-47)48-23-15-10-16-24-48/h7-42H,1-2H2,3-6H3 |
| InChIKey | OGDDXPNJXLWHLS-UHFFFAOYSA-N |
| XLogP | 17.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.09 |
| LogP ≤ 5 | 17.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|