C16H13F — CID 170408544
5-fluoro-6-phenyl-1,2-dihydronaphthalene (PubChem CID 170408544) has the molecular formula C16H13F and a molecular weight of 224.28 g/mol. Its IUPAC name is 5-fluoro-6-phenyl-1,2-dihydronaphthalene.
| Compound Name | 5-fluoro-6-phenyl-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 170408544 |
| Molecular Formula | C16H13F |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 5-fluoro-6-phenyl-1,2-dihydronaphthalene |
| SMILES | Fc1c(-c2ccccc2)ccc2c1C=CCC2 |
| InChI | InChI=1S/C16H13F/c17-16-14-9-5-4-8-13(14)10-11-15(16)12-6-2-1-3-7-12/h1-3,5-7,9-11H,4,8H2 |
| InChIKey | RQSUZRYPJYFDMX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |