C16H15Br — CID 123273491
11-bromotricyclo[8.6.0.02,7]hexadeca-1(10),2,4,6,8,15-hexaene (PubChem CID 123273491) has the molecular formula C16H15Br and a molecular weight of 287.20 g/mol. Its IUPAC name is 11-bromotricyclo[8.6.0.02,7]hexadeca-1(10),2,4,6,8,15-hexaene.
| Compound Name | 11-bromotricyclo[8.6.0.02,7]hexadeca-1(10),2,4,6,8,15-hexaene |
|---|---|
| PubChem CID | 123273491 |
| Molecular Formula | C16H15Br |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 11-bromotricyclo[8.6.0.02,7]hexadeca-1(10),2,4,6,8,15-hexaene |
| SMILES | BrC1CCCC=Cc2c1ccc1ccccc21 |
| InChI | InChI=1S/C16H15Br/c17-16-9-3-1-2-8-14-13-7-5-4-6-12(13)10-11-15(14)16/h2,4-8,10-11,16H,1,3,9H2 |
| InChIKey | VYAUXJSPTGZPJH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|