C28H24Si — CID 101485886
bis[(3S)-3H-cyclopenta[a]naphthalen-3-yl]-dimethylsilane (PubChem CID 101485886) has the molecular formula C28H24Si and a molecular weight of 388.59 g/mol. Its IUPAC name is bis[(3S)-3H-cyclopenta[a]naphthalen-3-yl]-dimethylsilane.
| Compound Name | bis[(3S)-3H-cyclopenta[a]naphthalen-3-yl]-dimethylsilane |
|---|---|
| PubChem CID | 101485886 |
| Molecular Formula | C28H24Si |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | bis[(3S)-3H-cyclopenta[a]naphthalen-3-yl]-dimethylsilane |
| SMILES | C[Si](C)([C@H]1C=Cc2c1ccc1ccccc21)[C@H]1C=Cc2c1ccc1ccccc21 |
| InChI | InChI=1S/C28H24Si/c1-29(2,27-17-15-23-21-9-5-3-7-19(21)11-13-25(23)27)28-18-16-24-22-10-6-4-8-20(22)12-14-26(24)28/h3-18,27-28H,1-2H3/t27-,28-/m0/s1 |
| InChIKey | MEJHEJGRAHMQRS-NSOVKSMOSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|