C18H17NO — CID 174852254
N-(2,4,4a,12a-tetrahydro-1H-chrysen-3-ylidene)hydroxylamine (PubChem CID 174852254) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is N-(2,4,4a,12a-tetrahydro-1H-chrysen-3-ylidene)hydroxylamine.
| Compound Name | N-(2,4,4a,12a-tetrahydro-1H-chrysen-3-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 174852254 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(2,4,4a,12a-tetrahydro-1H-chrysen-3-ylidene)hydroxylamine |
| SMILES | ON=C1CCC2C=Cc3c(ccc4ccccc34)C2C1 |
| InChI | InChI=1S/C18H17NO/c20-19-14-8-5-13-7-9-16-15-4-2-1-3-12(15)6-10-17(16)18(13)11-14/h1-4,6-7,9-10,13,18,20H,5,8,11H2 |
| InChIKey | DBLXUQODLQFMJY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|