C12H14N2 — CID 134331110
1-N-methyl-2-N-(1-phenylethenyl)propane-1,2-diimine (PubChem CID 134331110) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 1-N-methyl-2-N-(1-phenylethenyl)propane-1,2-diimine.
| Compound Name | 1-N-methyl-2-N-(1-phenylethenyl)propane-1,2-diimine |
|---|---|
| PubChem CID | 134331110 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1-N-methyl-2-N-(1-phenylethenyl)propane-1,2-diimine |
| SMILES | C=C(/N=C(C)/C=N/C)c1ccccc1 |
| InChI | InChI=1S/C12H14N2/c1-10(9-13-3)14-11(2)12-7-5-4-6-8-12/h4-9H,2H2,1,3H3/b13-9+,14-10+ |
| InChIKey | RZOZXTDPZKLEKZ-UTLPMFLDSA-N |
| XLogP | 2.82 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|